|
Application: |
Rubber initiator and others |
![]() |
|
English Name: |
N, N`ditolyi-P-phenyl diamine mixed |
|
|
CAS NO: |
68953-84-4 |
|
|
Molecular Weight: |
288.3862 |
|
|
EC NO: |
None |
|
|
Formula: |
C20H20N2 |
|
|
InChI: |
InChI=1/C20H20N2/c1-15-7-9-17(10-8-15)21-18-11-13-19(14-12-18)22-20-6-4-3-5-16(20)2/h3-14,21-22H,1-2H3 |
|
|
Packing: |
25kgs net in color printed peritoneal woven bag lined with polyethylene bag. |
|
|
Products introduction: |
CAS NO.: 68953-84-4 Appearance:Brown and grey articles Melting point(℃):90-100 Heating loss(%,65℃):≤0.5 Ash specification(%, 750℃):≤0.3 |
|
|
Other name: |
Anti-oxidant DTPD (3100) |
|
|
Structural formula: |
![]() |
|


Items with " * " are required to fill in.