Sodium Dimethyl Dithiocarbamate
|
Name: |
Sodium Dimethyl dithiocarbamate: LIQUID STATE |
 |
||||||||||||||||||||||||
|
CAS NO: |
||||||||||||||||||||||||||
|
Molecular Weight |
143.2062 |
|||||||||||||||||||||||||
|
EC NO: |
204-876-7 |
|||||||||||||||||||||||||
|
Molecular formula: |
C3H6NNaS2 |
|||||||||||||||||||||||||
|
InChI: |
InChI=1/C3H7NS2.Na/c1-4(2)3(5)6;/h1-2H3,(H,5,6);/q;+1/p-1/rC3H6NNaS2/c1-4(2)3(6)7-5/h1-2H3 |
|||||||||||||||||||||||||
|
Products details: |
Chemical name：Sodium Dimethyl dithiocarbamate Specification （specially used for synthetic rubber）：
Application：Mainly used for synthetic rubber(short-stopper), water treatment，fungicide, industrial bactericide, mineral separation，electroplate and so on. Packing： IRON drum,ISO tank and IBC drum used for liquid. Plastic bag and papar bag used for solid. |
|||||||||||||||||||||||||
|
StructuralFormula: |
 |
|||||||||||||||||||||||||
|
Name: |
Sodium Dimethyldithiocarbamate |
 |
|||||||||||||||
|
CAS NO: |
|||||||||||||||||
|
Molecular Weight |
143.2062 |
||||||||||||||||
|
EC NO: |
204-876-7 |
||||||||||||||||
|
Molecular formula: |
C3H6NNaS2 |
||||||||||||||||
|
InChI: |
InChI=1/C3H7NS2.Na/c1-4(2)3(5)6;/h1-2H3,(H,5,6);/q;+1/p-1/rC3H6NNaS2/c1-4(2)3(6)7-5/h1-2H3 |
||||||||||||||||
|
Products details: |
1、 Chemical name：Sodium Dimethyldithiocarbamate 2、Specification：
3、 Application：Mainly used for pharmaceuticals industry, water treatment, industrial bactericide, mineral separation and so on. 4、Packing： 25kg/bag |
||||||||||||||||
|
StructuralFormula: |
 |
||||||||||||||||