Sodium Dimethyl Dithiocarbamate
Name: |
Sodium Dimethyl dithiocarbamate: LIQUID STATE |
![]() |
||||||||||||||||||||||||
CAS NO: |
||||||||||||||||||||||||||
Molecular Weight |
143.2062 |
|||||||||||||||||||||||||
EC NO: |
204-876-7 |
|||||||||||||||||||||||||
Molecular formula: |
C3H6NNaS2 |
|||||||||||||||||||||||||
InChI: |
InChI=1/C3H7NS2.Na/c1-4(2)3(5)6;/h1-2H3,(H,5,6);/q;+1/p-1/rC3H6NNaS2/c1-4(2)3(6)7-5/h1-2H3 |
|||||||||||||||||||||||||
Products details: |
Chemical name:Sodium Dimethyl dithiocarbamate Specification (specially used for synthetic rubber):
Application:Mainly used for synthetic rubber(short-stopper), water treatment,fungicide, industrial bactericide, mineral separation,electroplate and so on. As chelating agent, used for waste incineration power plant to separate heavy metals from fly ash. Then, bury it under the ground Packing: IRON drum,ISO tank and IBC drum used for liquid. Plastic bag and papar bag used for solid. |
|||||||||||||||||||||||||
StructuralFormula: |
![]() |
Name: |
Sodium Dimethyldithiocarbamate |
![]() |
|||||||||||||||
CAS NO: |
|||||||||||||||||
Molecular Weight |
143.2062 |
||||||||||||||||
EC NO: |
204-876-7 |
||||||||||||||||
Molecular formula: |
C3H6NNaS2 |
||||||||||||||||
InChI: |
InChI=1/C3H7NS2.Na/c1-4(2)3(5)6;/h1-2H3,(H,5,6);/q;+1/p-1/rC3H6NNaS2/c1-4(2)3(6)7-5/h1-2H3 |
||||||||||||||||
Products details: |
1、 Chemical name:Sodium Dimethyldithiocarbamate 2、Specification:
3、 Application:Mainly used for pharmaceuticals industry, water treatment, industrial bactericide, mineral separation and so on. As chelating agent, used for waste incineration power plant to separate heavy metals from fly ash. Then, bury it under the ground 4、Packing: 25kg/bag |
||||||||||||||||
StructuralFormula: |
![]() |